Difference between revisions of "Cis-cis-D19-37-C56-2-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7417 == * common-name: ** cis-coumarinic acid-β-d-glucoside * molecular-weight: ** 325.294 * inchi-key: ** gvriyimnjgulcz-qlfwqt...")
 
(Created page with "Category:metabolite == Metabolite 5-ppp-Pur-mRNA == * common-name: ** a 5'-triphospho-purine-[mrna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-PH...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-7417 ==
+
== Metabolite 5-ppp-Pur-mRNA ==
 
* common-name:
 
* common-name:
−
** cis-coumarinic acid-β-d-glucoside
+
** a 5'-triphospho-purine-[mrna]
−
* molecular-weight:
 
−
** 325.294
 
−
* inchi-key:
 
−
** gvriyimnjgulcz-qlfwqtqqsa-m
 
−
* smiles:
 
−
** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8036]]
+
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=cis-coumarinic acid-β-d-glucoside}}
+
{{#set: common-name=a 5'-triphospho-purine-[mrna]}}
−
{{#set: molecular-weight=325.294}}
 
−
{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
 

Revision as of 17:55, 13 January 2021

Metabolite 5-ppp-Pur-mRNA

  • common-name:
    • a 5'-triphospho-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-triphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=Cis-cis-D19-37-C56-2-ACPs&oldid=18140"