Difference between revisions of "N-ACETYL-GLUTAMYL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-BUTYRATE == * common-name: ** 4-aminobutanoate * molecular-weight: ** 103.121 * inchi-key: ** btcsszjgundroe-uhfffaoysa-n * smile...") |
(Created page with "Category:metabolite == Metabolite CPD1F-114 == * common-name: ** all-trans-lycopene * molecular-weight: ** 536.882 * inchi-key: ** oaijszizwzsqbc-gyzmgtaesa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD1F-114 == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-lycopene |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 536.882 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oaijszizwzsqbc-gyzmgtaesa-n |
* smiles: | * smiles: | ||
| − | ** c(c | + | ** cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-147]] |
| − | * [[ | + | * [[RXN1F-150]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-lycopene}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=536.882}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oaijszizwzsqbc-gyzmgtaesa-n}} |
Revision as of 17:55, 13 January 2021
Contents
Metabolite CPD1F-114
- common-name:
- all-trans-lycopene
- molecular-weight:
- 536.882
- inchi-key:
- oaijszizwzsqbc-gyzmgtaesa-n
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(ccc=c(c)c)c)c)c
