Difference between revisions of "16S-rRNA-guanine-1207"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * molecular-weight: ** 170.165 * inchi-key: ** mtvwfvdwrvydor-qmmmgpobsa-n * smi...")
 
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * molecular-weight: ** 636.476 * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11878 ==
+
== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxyphenylglycol
+
** luteolin 7-o-β-d-diglucuronide
 
* molecular-weight:
 
* molecular-weight:
** 170.165
+
** 636.476
 
* inchi-key:
 
* inchi-key:
** mtvwfvdwrvydor-qmmmgpobsa-n
+
** pbbvwjqpazyqdb-dbfweqbmsa-l
 
* smiles:
 
* smiles:
** c(o)c(o)c1(c=cc(o)=c(o)c=1)
+
** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15288]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10911]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxyphenylglycol}}
+
{{#set: common-name=luteolin 7-o-β-d-diglucuronide}}
{{#set: molecular-weight=170.165}}
+
{{#set: molecular-weight=636.476}}
{{#set: inchi-key=inchikey=mtvwfvdwrvydor-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}

Revision as of 17:55, 13 January 2021

Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE

  • common-name:
    • luteolin 7-o-β-d-diglucuronide
  • molecular-weight:
    • 636.476
  • inchi-key:
    • pbbvwjqpazyqdb-dbfweqbmsa-l
  • smiles:
    • c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality