Difference between revisions of "CPD1G-124"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * common-name: ** 5-phospho-β-d-ribosylamine * molecular-weight: ** 228.118 * inchi-key: ** skcbpevygoqg...")
 
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * molecular-weight: ** 285.17 * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-P-BETA-D-RIBOSYL-AMINE ==
+
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
 
* common-name:
 
* common-name:
** 5-phospho-β-d-ribosylamine
+
** n1-(5-phospho-β-d-ribosyl)glycinamide
 
* molecular-weight:
 
* molecular-weight:
** 228.118
+
** 285.17
 
* inchi-key:
 
* inchi-key:
** skcbpevygoqgjn-txicztdvsa-m
+
** obqmlsfouzuiob-shuuezrqsa-m
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1)
+
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GART-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[GART-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
* [[PRPPAMIDOTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
* [[PRPPAMIDOTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-β-d-ribosylamine}}
+
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
{{#set: molecular-weight=228.118}}
+
{{#set: molecular-weight=285.17}}
{{#set: inchi-key=inchikey=skcbpevygoqgjn-txicztdvsa-m}}
+
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}

Revision as of 17:55, 13 January 2021

Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE

  • common-name:
    • n1-(5-phospho-β-d-ribosyl)glycinamide
  • molecular-weight:
    • 285.17
  • inchi-key:
    • obqmlsfouzuiob-shuuezrqsa-m
  • smiles:
    • c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality