Difference between revisions of "Nucleoside-Monophosphates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite glycols == * common-name: ** a glycol == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * [...") |
(Created page with "Category:metabolite == Metabolite L-DOPACHROME == * common-name: ** l-dopachrome * molecular-weight: ** 192.151 * inchi-key: ** vjncicvkuhkiiv-lurjtmiesa-m * smiles: ** c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-DOPACHROME == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-dopachrome |
| + | * molecular-weight: | ||
| + | ** 192.151 | ||
| + | * inchi-key: | ||
| + | ** vjncicvkuhkiiv-lurjtmiesa-m | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)c1(nc2(c(c1)=cc(=o)c(=o)c=2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11403]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-11369]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-dopachrome}} |
| + | {{#set: molecular-weight=192.151}} | ||
| + | {{#set: inchi-key=inchikey=vjncicvkuhkiiv-lurjtmiesa-m}} | ||
Revision as of 17:55, 13 January 2021
Contents
Metabolite L-DOPACHROME
- common-name:
- l-dopachrome
- molecular-weight:
- 192.151
- inchi-key:
- vjncicvkuhkiiv-lurjtmiesa-m
- smiles:
- c([o-])(=o)c1(nc2(c(c1)=cc(=o)c(=o)c=2))
