Difference between revisions of "PHE-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYR-tRNAs == * common-name: ** a trnatyr == Reaction(s) known to consume the compound == * TYROSINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYINDOLE == * common-name: ** 5,6-dihydroxyindole * molecular-weight: ** 149.149 * inchi-key: ** sgnzyjxnuurych-uhfffaoysa-n * smi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DIHYDROXYINDOLE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5,6-dihydroxyindole |
| + | * molecular-weight: | ||
| + | ** 149.149 | ||
| + | * inchi-key: | ||
| + | ** sgnzyjxnuurych-uhfffaoysa-n | ||
| + | * smiles: | ||
| + | ** c1(=cnc2(=c1c=c(o)c(o)=c2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11403]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5,6-dihydroxyindole}} |
| + | {{#set: molecular-weight=149.149}} | ||
| + | {{#set: inchi-key=inchikey=sgnzyjxnuurych-uhfffaoysa-n}} | ||
Revision as of 17:56, 13 January 2021
Contents
Metabolite DIHYDROXYINDOLE
- common-name:
- 5,6-dihydroxyindole
- molecular-weight:
- 149.149
- inchi-key:
- sgnzyjxnuurych-uhfffaoysa-n
- smiles:
- c1(=cnc2(=c1c=c(o)c(o)=c2))
