Difference between revisions of "CPD-696"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Beta-D-Mannosides == * common-name: ** a β-d-mannoside == Reaction(s) known to consume the compound == * 3.2.1.25-RXN == Reactio...") |
(Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * molecular-weight: ** 445.239 * inchi-key: ** wvimueuqjfpndk-pebgctimsa-m * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CDP-ETHANOLAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** cdp-ethanolamine |
| + | * molecular-weight: | ||
| + | ** 445.239 | ||
| + | * inchi-key: | ||
| + | ** wvimueuqjfpndk-pebgctimsa-m | ||
| + | * smiles: | ||
| + | ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.7.7.14-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cdp-ethanolamine}} |
| + | {{#set: molecular-weight=445.239}} | ||
| + | {{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}} | ||
Revision as of 17:56, 13 January 2021
Contents
Metabolite CDP-ETHANOLAMINE
- common-name:
- cdp-ethanolamine
- molecular-weight:
- 445.239
- inchi-key:
- wvimueuqjfpndk-pebgctimsa-m
- smiles:
- c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
