Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite T2-DECENOYL-COA == * common-name: ** (2e)-dec-2-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** mgnbgcrqqfmnbm-yjhhllfwsa-j * sm...")
 
(Created page with "Category:metabolite == Metabolite SORBITOL == * common-name: ** d-sorbitol * molecular-weight: ** 182.173 * inchi-key: ** fbpfztcfmrresa-jgwlitmvsa-n * smiles: ** c(c(c(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite T2-DECENOYL-COA ==
+
== Metabolite SORBITOL ==
 
* common-name:
 
* common-name:
−
** (2e)-dec-2-enoyl-coa
+
** d-sorbitol
 
* molecular-weight:
 
* molecular-weight:
−
** 915.738
+
** 182.173
 
* inchi-key:
 
* inchi-key:
−
** mgnbgcrqqfmnbm-yjhhllfwsa-j
+
** fbpfztcfmrresa-jgwlitmvsa-n
 
* smiles:
 
* smiles:
−
** cccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c(c(c(c(co)o)o)o)o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13616]]
+
* [[RXN-7644]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DIENOYLCOAREDUCT-RXN]]
+
* [[RXN-7644]]
−
* [[RXN-13615]]
+
* [[SORBITOL-6-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(2e)-dec-2-enoyl-coa}}
+
{{#set: common-name=d-sorbitol}}
−
{{#set: molecular-weight=915.738}}
+
{{#set: molecular-weight=182.173}}
−
{{#set: inchi-key=inchikey=mgnbgcrqqfmnbm-yjhhllfwsa-j}}
+
{{#set: inchi-key=inchikey=fbpfztcfmrresa-jgwlitmvsa-n}}

Revision as of 17:56, 13 January 2021

Metabolite SORBITOL

  • common-name:
    • d-sorbitol
  • molecular-weight:
    • 182.173
  • inchi-key:
    • fbpfztcfmrresa-jgwlitmvsa-n
  • smiles:
    • c(c(c(c(c(co)o)o)o)o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=D-6-P-GLUCONO-DELTA-LACTONE&oldid=18338"