Difference between revisions of "CPD-201"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11602 == * common-name: ** ergosterol 3-o-β-d-glucoside * molecular-weight: ** 558.797 * inchi-key: ** mkzpngbjjjzjmi-vnwfyegesa...") |
(Created page with "Category:metabolite == Metabolite MESO-DIAMINOPIMELATE == * common-name: ** meso-diaminopimelate * molecular-weight: ** 190.199 * inchi-key: ** gmkmezvlhjarhf-sydprgilsa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MESO-DIAMINOPIMELATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** meso-diaminopimelate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 190.199 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gmkmezvlhjarhf-sydprgilsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DIAMINOPIMDECARB-RXN]] | ||
| + | * [[DIAMINOPIMEPIM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DIAMINOPIMEPIM-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=meso-diaminopimelate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=190.199}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gmkmezvlhjarhf-sydprgilsa-n}} |
Revision as of 17:56, 13 January 2021
Contents
Metabolite MESO-DIAMINOPIMELATE
- common-name:
- meso-diaminopimelate
- molecular-weight:
- 190.199
- inchi-key:
- gmkmezvlhjarhf-sydprgilsa-n
- smiles:
- c(c(cccc(c([o-])=o)[n+])[n+])([o-])=o
