Difference between revisions of "TRP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5Z-3-oxo-tetradec-5-enoyl-ACPs == * common-name: ** a (5z)-3-oxo-tetradec-5-enoyl-[acp] == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite PHYTOENE == * common_name: ** all-trans-phytoene * smiles: ** cc(=cccc(=cccc(=cccc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c * inchi_k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHYTOENE == |
| − | * | + | * common_name: |
| − | ** | + | ** all-trans-phytoene |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c | ||
| + | * inchi_key: | ||
| + | ** inchikey=yvlpjigomtxxlp-kekokysksa-n | ||
| + | * molecular_weight: | ||
| + | ** 544.946 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-144]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1F-144]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=all-trans-phytoene}} |
| + | {{#set: inchi_key=inchikey=yvlpjigomtxxlp-kekokysksa-n}} | ||
| + | {{#set: molecular_weight=544.946 }} | ||
Revision as of 17:56, 13 January 2021
Contents
Metabolite PHYTOENE
- common_name:
- all-trans-phytoene
- smiles:
- cc(=cccc(=cccc(=cccc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
- inchi_key:
- inchikey=yvlpjigomtxxlp-kekokysksa-n
- molecular_weight:
- 544.946
