Difference between revisions of "FE+3"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10794 == * common_name: ** adp ribose 1''-phosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(...")
 
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * molecular-weight: ** 219.246 * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * smiles: ** cc(co)=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10794 ==
+
== Metabolite CPD-4441 ==
* common_name:
+
* common-name:
** adp ribose 1''-phosphate
+
** cis-zeatin
 +
* molecular-weight:
 +
** 219.246
 +
* inchi-key:
 +
** uzkqtcbamswpjd-uqcoibpssa-n
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)op(=o)([o-])[o-]))(=o)[o-]
+
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
* inchi_key:
 
** inchikey=cunfrfhbhmfvph-tyasjmozsa-j
 
* molecular_weight:
 
** 635.268   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10034]]
+
* [[RXN-4733]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12055]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=adp ribose 1''-phosphate}}
+
{{#set: common-name=cis-zeatin}}
{{#set: inchi_key=inchikey=cunfrfhbhmfvph-tyasjmozsa-j}}
+
{{#set: molecular-weight=219.246}}
{{#set: molecular_weight=635.268    }}
+
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}

Revision as of 17:56, 13 January 2021

Metabolite CPD-4441

  • common-name:
    • cis-zeatin
  • molecular-weight:
    • 219.246
  • inchi-key:
    • uzkqtcbamswpjd-uqcoibpssa-n
  • smiles:
    • cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality