Difference between revisions of "PLASTOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-HIS-tRNAs == * common-name: ** an l-histidyl-[trnahis] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite CPD-15663 == * common-name: ** 2-trans-nonenoyl-coa * molecular-weight: ** 901.711 * inchi-key: ** hblotzdypzazle-owqwvslfsa-j * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15663 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-trans-nonenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 901.711 | ||
| + | * inchi-key: | ||
| + | ** hblotzdypzazle-owqwvslfsa-j | ||
| + | * smiles: | ||
| + | ** ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14793]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-trans-nonenoyl-coa}} |
| + | {{#set: molecular-weight=901.711}} | ||
| + | {{#set: inchi-key=inchikey=hblotzdypzazle-owqwvslfsa-j}} | ||
Revision as of 17:56, 13 January 2021
Contents
Metabolite CPD-15663
- common-name:
- 2-trans-nonenoyl-coa
- molecular-weight:
- 901.711
- inchi-key:
- hblotzdypzazle-owqwvslfsa-j
- smiles:
- ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
