Difference between revisions of "S-CD-S-SP-Complex"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * molecular-weight: ** 221.167 * inchi-key: ** ocymerzcmyjqqo-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite BUTYRYL-COA == * common-name: ** butanoyl-coa * molecular-weight: ** 833.593 * inchi-key: ** crfngmnykdxrtn-hdrjhvaisa-j * smiles: ** ccc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BUTYRYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** butanoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 833.593 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** crfngmnykdxrtn-hdrjhvaisa-j |
* smiles: | * smiles: | ||
− | ** | + | ** cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[BUTYRYL-COA-DEHYDROGENASE-RXN]] |
+ | * [[RXN-12565]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[BUTYRYL-COA-DEHYDROGENASE-RXN]] | ||
+ | * [[RXN-12565]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=butanoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=833.593}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=crfngmnykdxrtn-hdrjhvaisa-j}} |
Revision as of 17:56, 13 January 2021
Contents
Metabolite BUTYRYL-COA
- common-name:
- butanoyl-coa
- molecular-weight:
- 833.593
- inchi-key:
- crfngmnykdxrtn-hdrjhvaisa-j
- smiles:
- cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]