Difference between revisions of "CPD-12482"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * molecular-weight: ** 620.928 * inchi-key: ** uowzuvnaguaeqc-uhfffaoysa-m * sm...")
 
(Created page with "Category:metabolite == Metabolite DEHYDROSPHINGANINE == * common-name: ** 3-dehydrosphinganine * molecular-weight: ** 300.504 * inchi-key: ** kbunosoggaarkz-krwdzbqosa-o *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11404 ==
+
== Metabolite DEHYDROSPHINGANINE ==
 
* common-name:
 
* common-name:
** 3,3',5-triiodothyroacetate
+
** 3-dehydrosphinganine
 
* molecular-weight:
 
* molecular-weight:
** 620.928
+
** 300.504
 
* inchi-key:
 
* inchi-key:
** uowzuvnaguaeqc-uhfffaoysa-m
+
** kbunosoggaarkz-krwdzbqosa-o
 
* smiles:
 
* smiles:
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2))
+
** cccccccccccccccc(c(co)[n+])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10618]]
 
* [[RXN-10619]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,3',5-triiodothyroacetate}}
+
{{#set: common-name=3-dehydrosphinganine}}
{{#set: molecular-weight=620.928}}
+
{{#set: molecular-weight=300.504}}
{{#set: inchi-key=inchikey=uowzuvnaguaeqc-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=kbunosoggaarkz-krwdzbqosa-o}}

Revision as of 17:57, 13 January 2021

Metabolite DEHYDROSPHINGANINE

  • common-name:
    • 3-dehydrosphinganine
  • molecular-weight:
    • 300.504
  • inchi-key:
    • kbunosoggaarkz-krwdzbqosa-o
  • smiles:
    • cccccccccccccccc(c(co)[n+])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality