Difference between revisions of "CPD-2961"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-Acylated-Aliphatic-Amino-Acids == * common-name: ** an n-acylated aliphatic-l-amino acid == Reaction(s) known to consume the compound =...") |
(Created page with "Category:metabolite == Metabolite CPD-824 == * common_name: ** 5-guanidino-2-oxo-pentanoate * smiles: ** c(c(cccnc(n)=[n+])=o)(=o)[o-] * inchi_key: ** inchikey=arbhxjxxvvh...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-824 == |
| − | * | + | * common_name: |
| − | ** | + | ** 5-guanidino-2-oxo-pentanoate |
| + | * smiles: | ||
| + | ** c(c(cccnc(n)=[n+])=o)(=o)[o-] | ||
| + | * inchi_key: | ||
| + | ** inchikey=arbhxjxxvvhmet-uhfffaoysa-n | ||
| + | * molecular_weight: | ||
| + | ** 173.171 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ARG-OXIDATION-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=5-guanidino-2-oxo-pentanoate}} |
| + | {{#set: inchi_key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}} | ||
| + | {{#set: molecular_weight=173.171 }} | ||
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-824
- common_name:
- 5-guanidino-2-oxo-pentanoate
- smiles:
- c(c(cccnc(n)=[n+])=o)(=o)[o-]
- inchi_key:
- inchikey=arbhxjxxvvhmet-uhfffaoysa-n
- molecular_weight:
- 173.171
