Difference between revisions of "CPD1G-204"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P == * common-name: ** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate * molecular-weight: ** 346...")
 
(Created page with "Category:metabolite == Metabolite CPD-12179 == * common-name: ** methylmalonate semialdehyde == Reaction(s) known to consume the compound == * 1.2.1.27-RXN == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBOXYPHENYLAMINO-DEOXYRIBULOSE-P ==
+
== Metabolite CPD-12179 ==
 
* common-name:
 
* common-name:
** 1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate
+
** methylmalonate semialdehyde
* molecular-weight:
 
** 346.21
 
* inchi-key:
 
** qkmbynrmprkvto-mnovxskesa-k
 
* smiles:
 
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cnc1(c=cc=cc(c(=o)[o-])=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[IGPSYN-RXN]]
+
* [[1.2.1.27-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRAISOM-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(o-carboxyphenylamino)-1'-deoxyribulose 5'-phosphate}}
+
{{#set: common-name=methylmalonate semialdehyde}}
{{#set: molecular-weight=346.21}}
 
{{#set: inchi-key=inchikey=qkmbynrmprkvto-mnovxskesa-k}}
 

Revision as of 17:57, 13 January 2021

Metabolite CPD-12179

  • common-name:
    • methylmalonate semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality