Difference between revisions of "CPD-18346"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cytochromes-C-Reduced == * common-name: ** a reduced c-type cytochrome == Reaction(s) known to consume the compound == * 1.10.2.2-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-8117 == * common-name: ** γ-linolenate * molecular-weight: ** 277.426 * inchi-key: ** vzccetwtmqhepk-qnebeihssa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8117 == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-linolenate |
| + | * molecular-weight: | ||
| + | ** 277.426 | ||
| + | * inchi-key: | ||
| + | ** vzccetwtmqhepk-qnebeihssa-m | ||
| + | * smiles: | ||
| + | ** cccccc=ccc=ccc=cccccc(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[R07063]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-linolenate}} |
| + | {{#set: molecular-weight=277.426}} | ||
| + | {{#set: inchi-key=inchikey=vzccetwtmqhepk-qnebeihssa-m}} | ||
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-8117
- common-name:
- γ-linolenate
- molecular-weight:
- 277.426
- inchi-key:
- vzccetwtmqhepk-qnebeihssa-m
- smiles:
- cccccc=ccc=ccc=cccccc(=o)[o-]
