Difference between revisions of "2-Lysophosphatidylcholines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * molecular-weight: ** 863.619 * inchi-key: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa |
+ | * molecular-weight: | ||
+ | ** 863.619 | ||
+ | * inchi-key: | ||
+ | ** pekyntfsobaabv-lqudnsjzsa-j | ||
+ | * smiles: | ||
+ | ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.1.1.178-RXN]] |
+ | * [[TIGLYLCOA-HYDROXY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[1.1.1.178-RXN]] | ||
+ | * [[TIGLYLCOA-HYDROXY-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}} |
+ | {{#set: molecular-weight=863.619}} | ||
+ | {{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA
- common-name:
- (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
- molecular-weight:
- 863.619
- inchi-key:
- pekyntfsobaabv-lqudnsjzsa-j
- smiles:
- cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o