Difference between revisions of "2-Lysophosphatidylcholines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...")
 
(Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * molecular-weight: ** 863.619 * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2352 ==
+
== Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA ==
 
* common-name:
 
* common-name:
** a trna precursor with a 5' extension and a short 3' extension
+
** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
 +
* molecular-weight:
 +
** 863.619
 +
* inchi-key:
 +
** pekyntfsobaabv-lqudnsjzsa-j
 +
* smiles:
 +
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.26.5-RXN]]
+
* [[1.1.1.178-RXN]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.1.1.178-RXN]]
 +
* [[TIGLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trna precursor with a 5' extension and a short 3' extension}}
+
{{#set: common-name=(2s,3s)-3-hydroxy-2-methylbutanoyl-coa}}
 +
{{#set: molecular-weight=863.619}}
 +
{{#set: inchi-key=inchikey=pekyntfsobaabv-lqudnsjzsa-j}}

Revision as of 17:57, 13 January 2021

Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA

  • common-name:
    • (2s,3s)-3-hydroxy-2-methylbutanoyl-coa
  • molecular-weight:
    • 863.619
  • inchi-key:
    • pekyntfsobaabv-lqudnsjzsa-j
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c(c)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality