Difference between revisions of "CPD-9700"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-form-FeS-Cluster-Scaffold-Proteins == * common-name: ** a [disordered-form [fe-s] cluster scaffold protein] == Reaction(s) known to con...")
 
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * molecular-weight: ** 256.257 * inchi-key: ** loyxtwzxlwhmbx-votsokgwsa-n * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-form-FeS-Cluster-Scaffold-Proteins ==
+
== Metabolite CPD-6993 ==
 
* common-name:
 
* common-name:
** a [disordered-form [fe-s] cluster scaffold protein]
+
** pinocembrin chalcone
 +
* molecular-weight:
 +
** 256.257
 +
* inchi-key:
 +
** loyxtwzxlwhmbx-votsokgwsa-n
 +
* smiles:
 +
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14381]]
+
* [[RXN-7647]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14391]]
+
* [[RXN-7645]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [disordered-form [fe-s] cluster scaffold protein]}}
+
{{#set: common-name=pinocembrin chalcone}}
 +
{{#set: molecular-weight=256.257}}
 +
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}

Revision as of 17:57, 13 January 2021

Metabolite CPD-6993

  • common-name:
    • pinocembrin chalcone
  • molecular-weight:
    • 256.257
  • inchi-key:
    • loyxtwzxlwhmbx-votsokgwsa-n
  • smiles:
    • c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality