Difference between revisions of "CPD0-971"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9864 == * common-name: ** 3-decaprenyl-4-hydroxybenzoate * molecular-weight: ** 818.297 * inchi-key: ** cmpnjzrebhcphn-ltnibbdrsa-m *...")
 
(Created page with "Category:metabolite == Metabolite CPD0-971 == * common-name: ** an α-limit dextrin == Reaction(s) known to consume the compound == == Reaction(s) known to produce th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9864 ==
+
== Metabolite CPD0-971 ==
 
* common-name:
 
* common-name:
** 3-decaprenyl-4-hydroxybenzoate
+
** an α-limit dextrin
* molecular-weight:
 
** 818.297
 
* inchi-key:
 
** cmpnjzrebhcphn-ltnibbdrsa-m
 
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9230]]
+
* [[GLYCOPHOSPHORYL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-decaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=an α-limit dextrin}}
{{#set: molecular-weight=818.297}}
 
{{#set: inchi-key=inchikey=cmpnjzrebhcphn-ltnibbdrsa-m}}
 

Revision as of 17:57, 13 January 2021

Metabolite CPD0-971

  • common-name:
    • an α-limit dextrin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality