Difference between revisions of "CPD0-2354"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-THR-tRNAs == * common-name: ** an l-threonyl-[trnathr] == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite CPD-19161 == * common-name: ** (2e,7z)-tetradecenoyl-coa * molecular-weight: ** 969.83 * inchi-key: ** mwksuvqqmpjtpp-dtpvmwfysa-j * smil...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19161 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,7z)-tetradecenoyl-coa |
+ | * molecular-weight: | ||
+ | ** 969.83 | ||
+ | * inchi-key: | ||
+ | ** mwksuvqqmpjtpp-dtpvmwfysa-j | ||
+ | * smiles: | ||
+ | ** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17793]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,7z)-tetradecenoyl-coa}} |
+ | {{#set: molecular-weight=969.83}} | ||
+ | {{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}} |
Revision as of 17:58, 13 January 2021
Contents
Metabolite CPD-19161
- common-name:
- (2e,7z)-tetradecenoyl-coa
- molecular-weight:
- 969.83
- inchi-key:
- mwksuvqqmpjtpp-dtpvmwfysa-j
- smiles:
- ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]