Difference between revisions of "D-mannopyranose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * molecular-weight: ** 453.324 * inchi-key: ** ankzybdxhmzbdk-scrdcrapsa-k * smiles: ** cc2(=cc1(n=c3(c(=o)[...")
 
(Created page with "Category:metabolite == Metabolite Protein-L-methionine == * common-name: ** a [protein]-l-methionine == Reaction(s) known to consume the compound == == Reaction(s) known t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FMN ==
+
== Metabolite Protein-L-methionine ==
 
* common-name:
 
* common-name:
** fmn
+
** a [protein]-l-methionine
* molecular-weight:
 
** 453.324
 
* inchi-key:
 
** ankzybdxhmzbdk-scrdcrapsa-k
 
* smiles:
 
** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FADSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RIBOFLAVINKIN-RXN]]
+
* [[1.8.4.12-RXN]]
 +
* [[RXN-8668]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fmn}}
+
{{#set: common-name=a [protein]-l-methionine}}
{{#set: molecular-weight=453.324}}
 
{{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}}
 

Revision as of 17:58, 13 January 2021

Metabolite Protein-L-methionine

  • common-name:
    • a [protein]-l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.