Difference between revisions of "Alpha-D-Galactosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * molecular-weight: ** 544.946 * inchi-key: ** yvlpjigomtxxlp-bhljudrvsa-n * smiles: ** cc...")
 
(Created page with "Category:metabolite == Metabolite Alpha-D-Galactosides == * common-name: ** an α-d-galactoside == Reaction(s) known to consume the compound == * RXN-12088 == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12321 ==
+
== Metabolite Alpha-D-Galactosides ==
 
* common-name:
 
* common-name:
** 15-cis-phytoene
+
** an α-d-galactoside
* molecular-weight:
 
** 544.946
 
* inchi-key:
 
** yvlpjigomtxxlp-bhljudrvsa-n
 
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12088]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13323]]
 
* [[RXNARA-8002]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15-cis-phytoene}}
+
{{#set: common-name=an α-d-galactoside}}
{{#set: molecular-weight=544.946}}
 
{{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}}
 

Revision as of 17:58, 13 January 2021

Metabolite Alpha-D-Galactosides

  • common-name:
    • an α-d-galactoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality