Difference between revisions of "Charged-fMET-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-glutamyl-tRNAGln == * common-name: ** an l-glutamyl-[trnagln] == Reaction(s) known to consume the compound == * 6.3.5.7-RXN == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-782 == * common-name: ** 3,4-dihydroxyphenylacetate * molecular-weight: ** 167.141 * inchi-key: ** cffzdzcdufsofz-uhfffaoysa-m * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-782 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxyphenylacetate |
| + | * molecular-weight: | ||
| + | ** 167.141 | ||
| + | * inchi-key: | ||
| + | ** cffzdzcdufsofz-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)cc1(c=cc(=c(c=1)o)o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN6666-5]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxyphenylacetate}} |
| + | {{#set: molecular-weight=167.141}} | ||
| + | {{#set: inchi-key=inchikey=cffzdzcdufsofz-uhfffaoysa-m}} | ||
Revision as of 17:58, 13 January 2021
Contents
Metabolite CPD-782
- common-name:
- 3,4-dihydroxyphenylacetate
- molecular-weight:
- 167.141
- inchi-key:
- cffzdzcdufsofz-uhfffaoysa-m
- smiles:
- c([o-])(=o)cc1(c=cc(=c(c=1)o)o)
