Difference between revisions of "CPD-707"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE == * common-name: ** indole * molecular-weight: ** 117.15 * inchi-key: ** sikjaqjrhwyjai-uhfffaoysa-n * smiles: ** c2(c=cc1(=c(c=c...") |
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * molecular-weight: ** 356.33 * inchi-key: ** jdmuprlruumctl-vifpvbqesa-l * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PANTETHEINE-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4'-phosphopantetheine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 356.33 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jdmuprlruumctl-vifpvbqesa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PANTEPADENYLYLTRAN-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.4.14-RXN]] |
| + | * [[P-PANTOCYSDECARB-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4'-phosphopantetheine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=356.33}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}} |
Revision as of 17:58, 13 January 2021
Contents
Metabolite PANTETHEINE-P
- common-name:
- 4'-phosphopantetheine
- molecular-weight:
- 356.33
- inchi-key:
- jdmuprlruumctl-vifpvbqesa-l
- smiles:
- cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
