Difference between revisions of "SINAPYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * molecular-weight: ** 174.113 * inchi-key: ** hlkxyzvtanabhz-reohclbh...") |
(Created page with "Category:metabolite == Metabolite S-CITRAMALATE == * common-name: ** (s)-citramalate * molecular-weight: ** 146.099 * inchi-key: ** xftrtwqbiomvpk-yfkpbyrvsa-l * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite S-CITRAMALATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-citramalate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 146.099 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xftrtwqbiomvpk-yfkpbyrvsa-l |
* smiles: | * smiles: | ||
| − | ** c(=o) | + | ** cc(o)(c(=o)[o-])cc(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CITRAMALATE-LYASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CITRAMALATE-LYASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-citramalate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xftrtwqbiomvpk-yfkpbyrvsa-l}} |
Revision as of 15:04, 15 March 2021
Contents
Metabolite S-CITRAMALATE
- common-name:
- (s)-citramalate
- molecular-weight:
- 146.099
- inchi-key:
- xftrtwqbiomvpk-yfkpbyrvsa-l
- smiles:
- cc(o)(c(=o)[o-])cc(=o)[o-]
