Difference between revisions of "CPD-444"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17370 == * common-name: ** 18-hydroxyoleoyl-coa * molecular-weight: ** 1043.952 * inchi-key: ** mqacsuxwiyyzak-utnxwdcosa-j * smiles:...")
(Created page with "Category:metabolite == Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 == * common-name: ** (5s)-hpete * molecular-weight: ** 335.462 * inchi-key: ** jnuunuqhxiofda-jgklhwies...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17370 ==
+
== Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6 ==
 
* common-name:
 
* common-name:
** 18-hydroxyoleoyl-coa
+
** (5s)-hpete
 
* molecular-weight:
 
* molecular-weight:
** 1043.952
+
** 335.462
 
* inchi-key:
 
* inchi-key:
** mqacsuxwiyyzak-utnxwdcosa-j
+
** jnuunuqhxiofda-jgklhwiesa-m
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cccccccc=ccccccccco)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8647]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16402]]
+
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxyoleoyl-coa}}
+
{{#set: common-name=(5s)-hpete}}
{{#set: molecular-weight=1043.952}}
+
{{#set: molecular-weight=335.462}}
{{#set: inchi-key=inchikey=mqacsuxwiyyzak-utnxwdcosa-j}}
+
{{#set: inchi-key=inchikey=jnuunuqhxiofda-jgklhwiesa-m}}

Revision as of 15:04, 15 March 2021

Metabolite 6E8Z11Z14Z-5S-5-HYDROPEROXYCOSA-6

  • common-name:
    • (5s)-hpete
  • molecular-weight:
    • 335.462
  • inchi-key:
    • jnuunuqhxiofda-jgklhwiesa-m
  • smiles:
    • cccccc=ccc=ccc=cc=cc(oo)cccc([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality