Difference between revisions of "ARG-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite epoxides == * common-name: ** an epoxide == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produ...") |
(Created page with "Category:metabolite == Metabolite 3-SULFINYL-PYRUVATE == * common-name: ** 3-sulfinopyruvate * molecular-weight: ** 150.106 * inchi-key: ** jxylqemxcaamol-uhfffaoysa-l * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-SULFINYL-PYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-sulfinopyruvate |
| + | * molecular-weight: | ||
| + | ** 150.106 | ||
| + | * inchi-key: | ||
| + | ** jxylqemxcaamol-uhfffaoysa-l | ||
| + | * smiles: | ||
| + | ** c(s([o-])=o)c(=o)c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[3 | + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-sulfinopyruvate}} |
| + | {{#set: molecular-weight=150.106}} | ||
| + | {{#set: inchi-key=inchikey=jxylqemxcaamol-uhfffaoysa-l}} | ||
Revision as of 15:05, 15 March 2021
Contents
Metabolite 3-SULFINYL-PYRUVATE
- common-name:
- 3-sulfinopyruvate
- molecular-weight:
- 150.106
- inchi-key:
- jxylqemxcaamol-uhfffaoysa-l
- smiles:
- c(s([o-])=o)c(=o)c(=o)[o-]
