Difference between revisions of "Aromatic-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Double-Stranded-DNAs == * common-name: ** a double stranded dna == Reaction(s) known to consume the compound == * 3.1.21.4-RXN * 5....") |
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * molecular-weight: ** 997.883 * inchi-key: ** yqarrkbgbkpbcx-dvzfgldusa-j * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19170 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,7z)-hexadecenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 997.883 | ||
| + | * inchi-key: | ||
| + | ** yqarrkbgbkpbcx-dvzfgldusa-j | ||
| + | * smiles: | ||
| + | ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17780]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,7z)-hexadecenoyl-coa}} |
| + | {{#set: molecular-weight=997.883}} | ||
| + | {{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}} | ||
Revision as of 15:05, 15 March 2021
Contents
Metabolite CPD-19170
- common-name:
- (2e,7z)-hexadecenoyl-coa
- molecular-weight:
- 997.883
- inchi-key:
- yqarrkbgbkpbcx-dvzfgldusa-j
- smiles:
- ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
