Difference between revisions of "METOH"

Revision as of 15:05, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14276 ==
+== Metabolite GERANYL-PP ==
-* common_name:
+* common-name:
-** (3r)-3-hydroxy-behenoyl-coa
+** geranyl diphosphate
+* molecular-weight:
+** 311.188
+* inchi-key:
+** gvvpgtzrzfnkds-jxmrogbwsa-k
 * smiles:
-** cccccccccccccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
+** cc(=cccc(=ccop([o-])(op(=o)([o-])[o-])=o)c)c
-* inchi_key:
-** inchikey=vnjqsrvxtrjvaz-zuiqssppsa-j
-* molecular_weight:
-** 1102.075
 == Reaction(s) known to consume the compound ==
-* [[RXN-13303]]
+* [[RXN-5109]]
+* [[RXN-5110]]
+* [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13299]]
+* [[GPPSYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common_name=(3r)-3-hydroxy-behenoyl-coa}}
+{{#set: common-name=geranyl diphosphate}}
-{{#set: inchi_key=inchikey=vnjqsrvxtrjvaz-zuiqssppsa-j}}
+{{#set: molecular-weight=311.188}}
-{{#set: molecular_weight=1102.075    }}
+{{#set: inchi-key=inchikey=gvvpgtzrzfnkds-jxmrogbwsa-k}}