Difference between revisions of "DNA-Guanines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * molecular-weight: ** 158.11 * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * smiles: ** c(cc(...") |
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * molecular-weight: ** 320.195 * inchi-key: ** gyozywvxfndglu-xlpzgreqsa-l * smiles: ** cc1(=cn(c(=o)nc(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** dtmp |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 320.195 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gyozywvxfndglu-xlpzgreqsa-l |
* smiles: | * smiles: | ||
| − | ** c(cc( | + | ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DTMPKI-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-5107]] | ||
| + | * [[THYMIDYLATESYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dtmp}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=320.195}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}} |
Revision as of 15:05, 15 March 2021
Contents
Metabolite TMP
- common-name:
- dtmp
- molecular-weight:
- 320.195
- inchi-key:
- gyozywvxfndglu-xlpzgreqsa-l
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
