Difference between revisions of "Protein-Histidines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-514 == * common-name: ** 3-oxo-3-phenylpropanoyl-coa * molecular-weight: ** 909.648 * inchi-key: ** nhdpiyiccbknnj-fueukbnzsa-j * smi...") |
(Created page with "Category:metabolite == Metabolite CPD-11526 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-enoyl)-coa * molecular-weight: ** 981.797 * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-11526 == |
* common-name: | * common-name: | ||
− | ** 3-oxo- | + | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-enoyl)-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 981.797 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qsaqfdywynlxec-guqxggmcsa-j |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc1(c(ccc(=o)1)cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-10705]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10707]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3-oxo- | + | {{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-enoyl)-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=981.797}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qsaqfdywynlxec-guqxggmcsa-j}} |
Revision as of 15:05, 15 March 2021
Contents
Metabolite CPD-11526
- common-name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(e-buta-2-enoyl)-coa
- molecular-weight:
- 981.797
- inchi-key:
- qsaqfdywynlxec-guqxggmcsa-j
- smiles:
- ccc=ccc1(c(ccc(=o)1)cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])