Difference between revisions of "ASN-tRNAs"

Revision as of 15:06, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-19144 ==
+== Metabolite CPD-19013 ==
 * common-name:
-** (7z)-hexadecenoyl-coa
+** 2-methylpropane-1,2-diol
 * molecular-weight:
-** 999.899
+** 90.122
 * inchi-key:
-** mjwmoldkmbisob-ydggzukgsa-j
+** btvwzwfkmiusgs-uhfffaoysa-n
 * smiles:
-** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** cc(o)(c)co
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-17778]]
+* [[RXN-17589]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(7z)-hexadecenoyl-coa}}
+{{#set: common-name=2-methylpropane-1,2-diol}}
-{{#set: molecular-weight=999.899}}
+{{#set: molecular-weight=90.122}}
-{{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}}
+{{#set: inchi-key=inchikey=btvwzwfkmiusgs-uhfffaoysa-n}}