Difference between revisions of "OH-ACYL-ACP"

Revision as of 15:06, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite D-METHYL-MALONYL-COA ==
+== Metabolite CATECHOL ==
 * common-name:
-** (s)-methylmalonyl-coa
+** catechol
 * molecular-weight:
-** 862.568
+** 110.112
 * inchi-key:
-** mzfokikepguzen-ibnuzsncsa-i
+** ycimnllnpgfghc-uhfffaoysa-n
 * smiles:
-** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o
+** c1(c=cc(=c(c=1)o)o)
 == Reaction(s) known to consume the compound ==
-* [[METHYLMALONYL-COA-EPIM-RXN]]
-* [[PROPIONYL-COA-CARBOXY-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[METHYLMALONYL-COA-EPIM-RXN]]
+* [[RXN-3661]]
-* [[PROPIONYL-COA-CARBOXY-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-methylmalonyl-coa}}
+{{#set: common-name=catechol}}
-{{#set: molecular-weight=862.568}}
+{{#set: molecular-weight=110.112}}
-{{#set: inchi-key=inchikey=mzfokikepguzen-ibnuzsncsa-i}}
+{{#set: inchi-key=inchikey=ycimnllnpgfghc-uhfffaoysa-n}}