Difference between revisions of "RETINOATE"

Revision as of 15:06, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11519 ==
+== Metabolite Uracil-54-in-tRNA ==
 * common-name:
-** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa
+** a uracil54 in trna
-* molecular-weight:
-** 1055.92
-* inchi-key:
-** pddhcvxpabqiso-xjjfhseksa-j
-* smiles:
-** ccc=ccc1(c(ccc(=o)1)cccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 == Reaction(s) known to consume the compound ==
-* [[RXN-10698]]
+* [[2.1.1.74-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10697]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyoctanoyl)-coa}}
+{{#set: common-name=a uracil54 in trna}}
-{{#set: molecular-weight=1055.92}}
-{{#set: inchi-key=inchikey=pddhcvxpabqiso-xjjfhseksa-j}}