Difference between revisions of "Trans-D2-cis-cis-D17-35-C54-3-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BILIVERDINE == * common-name: ** (z,z)-biliverdin-ix α * molecular-weight: ** 580.639 * inchi-key: ** qbuvfdktzjnupp-bbroenkcsa-l *...")
(Created page with "Category:metabolite == Metabolite D-METHYL-MALONYL-COA == * common-name: ** (s)-methylmalonyl-coa * molecular-weight: ** 862.568 * inchi-key: ** mzfokikepguzen-ibnuzsncsa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BILIVERDINE ==
+
== Metabolite D-METHYL-MALONYL-COA ==
 
* common-name:
 
* common-name:
** (z,z)-biliverdin-ix α
+
** (s)-methylmalonyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 580.639
+
** 862.568
 
* inchi-key:
 
* inchi-key:
** qbuvfdktzjnupp-bbroenkcsa-l
+
** mzfokikepguzen-ibnuzsncsa-i
 
* smiles:
 
* smiles:
** c=cc1(=c(c)c(nc1=cc4(=c(c)c(ccc(=o)[o-])=c(c=c2(c(ccc(=o)[o-])=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.3.7.4-RXN]]
+
* [[METHYLMALONYL-COA-EPIM-RXN]]
* [[BILIVERDIN-REDUCTASE-RXN]]
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* [[METHYLMALONYL-COA-EPIM-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(z,z)-biliverdin-ix α}}
+
{{#set: common-name=(s)-methylmalonyl-coa}}
{{#set: molecular-weight=580.639}}
+
{{#set: molecular-weight=862.568}}
{{#set: inchi-key=inchikey=qbuvfdktzjnupp-bbroenkcsa-l}}
+
{{#set: inchi-key=inchikey=mzfokikepguzen-ibnuzsncsa-i}}

Revision as of 15:06, 15 March 2021

Metabolite D-METHYL-MALONYL-COA

  • common-name:
    • (s)-methylmalonyl-coa
  • molecular-weight:
    • 862.568
  • inchi-key:
    • mzfokikepguzen-ibnuzsncsa-i
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality