Difference between revisions of "Fatty-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1091 == * common-name: ** (s)-ureidoglycolate * molecular-weight: ** 133.083 * inchi-key: ** nwzyycviokvtii-sfowxeaesa-m * smiles: **...") |
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * molecular-weight: ** 288.256 * inchi-key: ** padqinqhpqkxnl-lsdhhaius...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROKAEMPFEROL-CMPD == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (+)-dihydrokaempferol |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 288.256 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** padqinqhpqkxnl-lsdhhaiusa-n |
* smiles: | * smiles: | ||
− | ** c(o)(c( | + | ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] | ||
+ | * [[RXN1F-93]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(+)-dihydrokaempferol}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=288.256}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}} |
Revision as of 15:06, 15 March 2021
Contents
Metabolite DIHYDROKAEMPFEROL-CMPD
- common-name:
- (+)-dihydrokaempferol
- molecular-weight:
- 288.256
- inchi-key:
- padqinqhpqkxnl-lsdhhaiusa-n
- smiles:
- c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))