Difference between revisions of "2E-5Z-tetradeca-2-5-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14394 == * common-name: ** (8z,11z,14z,17z)-icosatetraenoyl-coa * molecular-weight: ** 1049.959 * inchi-key: ** plhicykopitjjt-qwoxcl...")
(Created page with "Category:metabolite == Metabolite TETRADEHYDROACYL-COA == * common-name: ** a (2e,4e)-alka-2,4-dienoyl-coa == Reaction(s) known to consume the compound == * RXN-12521...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-14394 ==
+
== Metabolite TETRADEHYDROACYL-COA ==
 
* common-name:
 
* common-name:
−
** (8z,11z,14z,17z)-icosatetraenoyl-coa
+
** a (2e,4e)-alka-2,4-dienoyl-coa
−
* molecular-weight:
 
−
** 1049.959
 
−
* inchi-key:
 
−
** plhicykopitjjt-qwoxclfssa-j
 
−
* smiles:
 
−
** ccc=ccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16042]]
+
* [[RXN-12521]]
 +
* [[RXN-7911]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(8z,11z,14z,17z)-icosatetraenoyl-coa}}
+
{{#set: common-name=a (2e,4e)-alka-2,4-dienoyl-coa}}
−
{{#set: molecular-weight=1049.959}}
 
−
{{#set: inchi-key=inchikey=plhicykopitjjt-qwoxclfssa-j}}
 

Revision as of 15:06, 15 March 2021

Metabolite TETRADEHYDROACYL-COA

  • common-name:
    • a (2e,4e)-alka-2,4-dienoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2E-5Z-tetradeca-2-5-dienoyl-ACPs&oldid=27699"