Difference between revisions of "Protein-tyrosine-phosphates"

Revision as of 15:06, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-6701 ==
+== Metabolite SER ==
 * common-name:
-** 1d-myo-inositol 5-monophosphate
+** l-serine
 * molecular-weight:
-** 258.121
+** 105.093
 * inchi-key:
-** inapmgsxuvuwaf-kxxvrosksa-l
+** mtcfgrxmjlqnbg-reohclbhsa-n
 * smiles:
-** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+** c(o)c([n+])c(=o)[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN-10953]]
+* [[4.3.1.17-RXN]]
+* [[5.1.1.18-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[GLYOHMETRANS-RXN]]
+* [[GLYOHMETRANS-RXN-SER/THF//GLY/METHYLENE-THF/WATER.33.]]
+* [[RXN-15125]]
+* [[RXN-5641]]
+* [[RXN0-2161]]
+* [[RXN0-2382]]
+* [[SERINE--TRNA-LIGASE-RXN]]
+* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
+* [[SERINE-O-ACETTRAN-RXN]]
+* [[TRYPSYN-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[GLYOHMETRANS-RXN]]
+* [[GLYOHMETRANS-RXN-SER/THF//GLY/METHYLENE-THF/WATER.33.]]
+* [[RXN-14136]]
+* [[RXN0-5114]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1d-myo-inositol 5-monophosphate}}
+{{#set: common-name=l-serine}}
-{{#set: molecular-weight=258.121}}
+{{#set: molecular-weight=105.093}}
-{{#set: inchi-key=inchikey=inapmgsxuvuwaf-kxxvrosksa-l}}
+{{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-reohclbhsa-n}}