Difference between revisions of "ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-706 == * common-name: ** 24-methylenecholesterol * molecular-weight: ** 398.671 * inchi-key: ** indvlxyucbvvkw-pxbbazsnsa-n * smiles:...")
(Created page with "Category:metabolite == Metabolite CPD-12199 == * common-name: ** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa * molecular-weight: ** 927.663 * inchi-key: ** vddfxumtxcqmfm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-706 ==
+
== Metabolite CPD-12199 ==
 
* common-name:
 
* common-name:
** 24-methylenecholesterol
+
** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 398.671
+
** 927.663
 
* inchi-key:
 
* inchi-key:
** indvlxyucbvvkw-pxbbazsnsa-n
+
** vddfxumtxcqmfm-ugdqnksbsa-j
 
* smiles:
 
* smiles:
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11245]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-707]]
+
* [[RXN-11244]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=24-methylenecholesterol}}
+
{{#set: common-name=3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa}}
{{#set: molecular-weight=398.671}}
+
{{#set: molecular-weight=927.663}}
{{#set: inchi-key=inchikey=indvlxyucbvvkw-pxbbazsnsa-n}}
+
{{#set: inchi-key=inchikey=vddfxumtxcqmfm-ugdqnksbsa-j}}

Revision as of 15:06, 15 March 2021

Metabolite CPD-12199

  • common-name:
    • 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
  • molecular-weight:
    • 927.663
  • inchi-key:
    • vddfxumtxcqmfm-ugdqnksbsa-j
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality