Difference between revisions of "CPD-464"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CADAVERINE == * common-name: ** cadaverine * molecular-weight: ** 104.195 * inchi-key: ** vhrgrcvqafmjiz-uhfffaoysa-p * smiles: ** c([n+]...") |
(Created page with "Category:metabolite == Metabolite IMP == * common-name: ** imp * molecular-weight: ** 346.193 * inchi-key: ** grszfwquakgdav-kqynxxcusa-l * smiles: ** c(op(=o)([o-])[o-])c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite IMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** imp |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 346.193 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** grszfwquakgdav-kqynxxcusa-l |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ADENYLOSUCCINATE-SYNTHASE-RXN]] |
| − | * [[ | + | * [[IMP-DEHYDROG-RXN]] |
| + | * [[IMPCYCLOHYDROLASE-RXN]] | ||
| + | * [[RXN-7607]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[AMP-DEAMINASE-RXN]] | ||
| + | * [[IMP-DEHYDROG-RXN]] | ||
| + | * [[IMPCYCLOHYDROLASE-RXN]] | ||
| + | * [[RXN-14003]] | ||
| + | * [[RXN0-6382]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=imp}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=346.193}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=grszfwquakgdav-kqynxxcusa-l}} |
Revision as of 15:06, 15 March 2021
Contents
Metabolite IMP
- common-name:
- imp
- molecular-weight:
- 346.193
- inchi-key:
- grszfwquakgdav-kqynxxcusa-l
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
