Difference between revisions of "DUMP"

Revision as of 15:06, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP ==
+== Metabolite Cytochromes-C-Oxidized ==
 * common-name:
-** 4-amino-2-methyl-5-(diphosphooxymethyl)pyrimidine
+** an oxidized c-type cytochrome
-* molecular-weight:
-** 296.093
-* inchi-key:
-** agqjqcfepuvxnk-uhfffaoysa-k
-* smiles:
-** cc1(n=c(n)c(=cn=1)cop(op([o-])([o-])=o)([o-])=o)
 == Reaction(s) known to consume the compound ==
-* [[RXN-12610]]
+* [[1.10.2.2-RXN]]
-* [[RXN-12611]]
+* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
-* [[THI-P-SYN-RXN]]
+* [[L-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
+* [[RXN-12876]]
+* [[RXN-14107]]
+* [[RXN-15815]]
+* [[RXN-15816]]
 == Reaction(s) known to produce the compound ==
-* [[PYRIMSYN3-RXN]]
+* [[1.10.2.2-RXN]]
+* [[CYTOCHROME-C-OXIDASE-RXN]]
+* [[RXN-15830]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-amino-2-methyl-5-(diphosphooxymethyl)pyrimidine}}
+{{#set: common-name=an oxidized c-type cytochrome}}
-{{#set: molecular-weight=296.093}}
-{{#set: inchi-key=inchikey=agqjqcfepuvxnk-uhfffaoysa-k}}