Difference between revisions of "CPD-7671"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * molecul...")
(Created page with "Category:metabolite == Metabolite KYNURENATE == * common-name: ** kynurenate * molecular-weight: ** 187.154 * inchi-key: ** hczhheifkropdy-uhfffaoysa-l * smiles: ** c1(c=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite C1 ==
+
== Metabolite KYNURENATE ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** kynurenate
 
* molecular-weight:
 
* molecular-weight:
** 1189.924
+
** 187.154
 
* inchi-key:
 
* inchi-key:
** imwoxezvyqdrdf-mczxnmlpsa-j
+
** hczhheifkropdy-uhfffaoysa-l
 
* smiles:
 
* smiles:
** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(=o)op([o-])(=o)occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))
+
** c1(c=c2(c(=cc=1)n=c(c(=o)[o-])c=c([o-])2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSNACMURPENTATRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10720]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
{{#set: common-name=kynurenate}}
{{#set: molecular-weight=1189.924}}
+
{{#set: molecular-weight=187.154}}
{{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}}
+
{{#set: inchi-key=inchikey=hczhheifkropdy-uhfffaoysa-l}}

Revision as of 15:07, 15 March 2021

Metabolite KYNURENATE

  • common-name:
    • kynurenate
  • molecular-weight:
    • 187.154
  • inchi-key:
    • hczhheifkropdy-uhfffaoysa-l
  • smiles:
    • c1(c=c2(c(=cc=1)n=c(c(=o)[o-])c=c([o-])2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality