Difference between revisions of "Fatty-Aldehydes"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-30 == * common-name: ** 4-acetamidobutanal * molecular-weight: ** 129.158 * inchi-key: ** ddslgzoyepkpsj-uhfffaoysa-n * smiles: ** cc...") |
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * molecular-weight: ** 335.462 * inchi-key: ** vnyssyrcgwbhlg-amolwhm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == |
* common-name: | * common-name: | ||
| − | ** | + | ** leukotriene b4 |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 335.462 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vnyssyrcgwbhlg-amolwhmgsa-m |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LEUKOTRIENE-A4-HYDROLASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=leukotriene b4}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=335.462}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vnyssyrcgwbhlg-amolwhmgsa-m}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI
- common-name:
- leukotriene b4
- molecular-weight:
- 335.462
- inchi-key:
- vnyssyrcgwbhlg-amolwhmgsa-m
- smiles:
- cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-]
