Difference between revisions of "5-10-METHENYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * molecular-weight: ** 228.095 * inchi-key: ** yxjdfqjkerbobm-txicztdvsa-l *...")
(Created page with "Category:metabolite == Metabolite CPD-11528 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa * molecular-weight: ** 997.797 * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOSE-1P ==
+
== Metabolite CPD-11528 ==
 
* common-name:
 
* common-name:
** α-d-ribose-1-phosphate
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 997.797
 
* inchi-key:
 
* inchi-key:
** yxjdfqjkerbobm-txicztdvsa-l
+
** qgjlcxxjefrwhp-jqukjzmasa-j
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
+
** ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[INOPHOSPHOR-RXN]]
+
* [[RXN-10701]]
* [[PPENTOMUT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[INOPHOSPHOR-RXN]]
+
* [[RXN-10703]]
* [[PPENTOMUT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose-1-phosphate}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=997.797}}
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
+
{{#set: inchi-key=inchikey=qgjlcxxjefrwhp-jqukjzmasa-j}}

Revision as of 15:07, 15 March 2021

Metabolite CPD-11528

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxobutanoyl)-coa
  • molecular-weight:
    • 997.797
  • inchi-key:
    • qgjlcxxjefrwhp-jqukjzmasa-j
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality