Difference between revisions of "Charged-TRP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1789 == * common-name: ** dehydro-d-arabinono-1,4-lactone * molecular-weight: ** 146.099 * inchi-key: ** zzzcuofihgpkak-uwtatzphsa-n...") |
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * molecular-weight: ** 206.177 * inchi-key: ** caovwyzqmpnafj-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-476 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-(2-aminophenyl)-2,4-dioxobutanoate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 206.177 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** caovwyzqmpnafj-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.6.1.63-RXN]] | ||
| + | * [[2.6.1.7-RXN]] | ||
| + | * [[RXN-10720]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[1.1. | + | * [[2.6.1.63-RXN]] |
| + | * [[2.6.1.7-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=206.177}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite CPD-476
- common-name:
- 4-(2-aminophenyl)-2,4-dioxobutanoate
- molecular-weight:
- 206.177
- inchi-key:
- caovwyzqmpnafj-uhfffaoysa-m
- smiles:
- c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
