Difference between revisions of "CPD-1789"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite carboxybiotin-L-lysine-in-BCCP-dimers == * common-name: ** a [carboxyl-carrier protein dimer]-n6-carboxybiotinyl-l-lysine == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-567 == * common-name: ** n6-acetyl-l-lysine * molecular-weight: ** 188.226 * inchi-key: ** dterqygmudwyaz-zetcqymhsa-n * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-567 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-acetyl-l-lysine |
| + | * molecular-weight: | ||
| + | ** 188.226 | ||
| + | * inchi-key: | ||
| + | ** dterqygmudwyaz-zetcqymhsa-n | ||
| + | * smiles: | ||
| + | ** cc(nccccc([n+])c(=o)[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-acetyl-l-lysine}} |
| + | {{#set: molecular-weight=188.226}} | ||
| + | {{#set: inchi-key=inchikey=dterqygmudwyaz-zetcqymhsa-n}} | ||
Revision as of 15:07, 15 March 2021
Contents
Metabolite CPD-567
- common-name:
- n6-acetyl-l-lysine
- molecular-weight:
- 188.226
- inchi-key:
- dterqygmudwyaz-zetcqymhsa-n
- smiles:
- cc(nccccc([n+])c(=o)[o-])=o
