Difference between revisions of "GLUTATHIONE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * molecular-weight: ** 178.141 * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-n * smil...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-1242 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-keto-β-d-galactose |
+ | * molecular-weight: | ||
+ | ** 178.141 | ||
+ | * inchi-key: | ||
+ | ** apiqnbnbiiccon-fkmsrsahsa-n | ||
+ | * smiles: | ||
+ | ** c(o)c1(oc(c(c(c1o)=o)o)o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[KETOLACTOSE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-keto-β-d-galactose}} |
+ | {{#set: molecular-weight=178.141}} | ||
+ | {{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite CPD-1242
- common-name:
- 3-keto-β-d-galactose
- molecular-weight:
- 178.141
- inchi-key:
- apiqnbnbiiccon-fkmsrsahsa-n
- smiles:
- c(o)c1(oc(c(c(c1o)=o)o)o)