Difference between revisions of "GLUTATHIONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Elongation-tRNAMet == * common-name: ** elongator trnamet == Reaction(s) known to consume the compound == * METHIONINE--TRNA-LIGASE-RXN...")
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * molecular-weight: ** 178.141 * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-n * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Elongation-tRNAMet ==
+
== Metabolite CPD-1242 ==
 
* common-name:
 
* common-name:
** elongator trnamet
+
** 3-keto-β-d-galactose
 +
* molecular-weight:
 +
** 178.141
 +
* inchi-key:
 +
** apiqnbnbiiccon-fkmsrsahsa-n
 +
* smiles:
 +
** c(o)c1(oc(c(c(c1o)=o)o)o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHIONINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[KETOLACTOSE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=elongator trnamet}}
+
{{#set: common-name=3-keto-β-d-galactose}}
 +
{{#set: molecular-weight=178.141}}
 +
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}

Revision as of 15:07, 15 March 2021

Metabolite CPD-1242

  • common-name:
    • 3-keto-β-d-galactose
  • molecular-weight:
    • 178.141
  • inchi-key:
    • apiqnbnbiiccon-fkmsrsahsa-n
  • smiles:
    • c(o)c1(oc(c(c(c1o)=o)o)o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality