Difference between revisions of "Ox-Glutaredoxins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MANNOSE == * common-name: ** d-mannose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...")
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * molecular-weight: ** 345.208 * inchi-key: ** ltfmzdnnppeqng-kvqbguixsa-l * smiles: ** c(op(=o)([o-])[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MANNOSE ==
+
== Metabolite DGMP ==
 
* common-name:
 
* common-name:
** d-mannose
+
** dgmp
 +
* molecular-weight:
 +
** 345.208
 +
* inchi-key:
 +
** ltfmzdnnppeqng-kvqbguixsa-l
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GMKALT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.113-RXN]]
+
* [[RXN0-385]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-mannose}}
+
{{#set: common-name=dgmp}}
 +
{{#set: molecular-weight=345.208}}
 +
{{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}}

Revision as of 15:07, 15 March 2021

Metabolite DGMP

  • common-name:
    • dgmp
  • molecular-weight:
    • 345.208
  • inchi-key:
    • ltfmzdnnppeqng-kvqbguixsa-l
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality