Difference between revisions of "CPD-18077"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROTEIN-C-TERMINAL-S-ETC-CYSTEINE == * common-name: ** a [protein] c-terminal s-farnesyl-l-cysteine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-13524 == * common-name: ** all-trans-retinol * molecular-weight: ** 286.456 * inchi-key: ** fpipgxgpppqfeq-ovsjkpmpsa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13524 == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-retinol |
| + | * molecular-weight: | ||
| + | ** 286.456 | ||
| + | * inchi-key: | ||
| + | ** fpipgxgpppqfeq-ovsjkpmpsa-n | ||
| + | * smiles: | ||
| + | ** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.3.99.23-RXN]] |
| + | * [[RETINOL-DEHYDROGENASE-RXN]] | ||
| + | * [[RXN-10841]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.1.64-RXN]] | ||
| + | * [[RETINOL-DEHYDROGENASE-RXN]] | ||
| + | * [[RXN-10841]] | ||
| + | * [[RXN-12575]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-retinol}} |
| + | {{#set: molecular-weight=286.456}} | ||
| + | {{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}} | ||
Revision as of 15:07, 15 March 2021
Contents
Metabolite CPD-13524
- common-name:
- all-trans-retinol
- molecular-weight:
- 286.456
- inchi-key:
- fpipgxgpppqfeq-ovsjkpmpsa-n
- smiles:
- cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
